C11H11F3N2O3S — CID 28860934
6-methyl-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 28860934) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 6-methyl-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | 6-methyl-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 28860934 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 6-methyl-2-[(2,2,2-trifluoroacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | C[NH+]1CCc2c(sc(NC(=O)C(F)(F)F)c2C(=O)[O-])C1 |
| InChI | InChI=1S/C11H11F3N2O3S/c1-16-3-2-5-6(4-16)20-8(7(5)9(17)18)15-10(19)11(12,13)14/h2-4H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | YOKZMFLKLRZRCQ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |