C15H21N3O4S — CID 39176043
4-[(2-acetamido-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carbonyl)amino]butanoate (PubChem CID 39176043) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[(2-acetamido-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carbonyl)amino]butanoate.
| Compound Name | 4-[(2-acetamido-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 39176043 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-[(2-acetamido-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carbonyl)amino]butanoate |
| SMILES | CC(=O)Nc1sc2c(c1C(=O)NCCCC(=O)[O-])CC[NH+](C)C2 |
| InChI | InChI=1S/C15H21N3O4S/c1-9(19)17-15-13(14(22)16-6-3-4-12(20)21)10-5-7-18(2)8-11(10)23-15/h3-8H2,1-2H3,(H,16,22)(H,17,19)(H,20,21) |
| InChIKey | TUZPQZHADJAXPD-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|