C22H29N2O4S+ — CID 7135910
ethyl 2-[(4-butoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate (PubChem CID 7135910) has the molecular formula C22H29N2O4S+ and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl 2-[(4-butoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate.
| Compound Name | ethyl 2-[(4-butoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
|---|---|
| PubChem CID | 7135910 |
| Molecular Formula | C22H29N2O4S+ |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | ethyl 2-[(4-butoxybenzoyl)amino]-6-methyl-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-6-ium-3-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)Nc2sc3c(c2C(=O)OCC)CC[NH+](C)C3)cc1 |
| InChI | InChI=1S/C22H28N2O4S/c1-4-6-13-28-16-9-7-15(8-10-16)20(25)23-21-19(22(26)27-5-2)17-11-12-24(3)14-18(17)29-21/h7-10H,4-6,11-14H2,1-3H3,(H,23,25)/p+1 |
| InChIKey | DVVRCESESALLNN-UHFFFAOYSA-O |
| XLogP | 2.93 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|