C21H16ClN3O2 — CID 28862516
(2E)-7-amino-4-[(3-chlorophenyl)methyl]-2-(pyridin-2-ylmethylidene)-1,4-benzoxazin-3-one (PubChem CID 28862516) has the molecular formula C21H16ClN3O2 and a molecular weight of 377.83 g/mol. Its IUPAC name is (2E)-7-amino-4-[(3-chlorophenyl)methyl]-2-(pyridin-2-ylmethylidene)-1,4-benzoxazin-3-one.
| Compound Name | (2E)-7-amino-4-[(3-chlorophenyl)methyl]-2-(pyridin-2-ylmethylidene)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28862516 |
| Molecular Formula | C21H16ClN3O2 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | (2E)-7-amino-4-[(3-chlorophenyl)methyl]-2-(pyridin-2-ylmethylidene)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)O/C(=C/c1ccccn1)C(=O)N2Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16ClN3O2/c22-15-5-3-4-14(10-15)13-25-18-8-7-16(23)11-19(18)27-20(21(25)26)12-17-6-1-2-9-24-17/h1-12H,13,23H2/b20-12+ |
| InChIKey | OHDLTQMFSKAUQQ-UDWIEESQSA-N |
| XLogP | 4.28 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|