C8H13F2NO2 — CID 28869402
(3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylic acid (PubChem CID 28869402) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 28869402 |
| Molecular Formula | C8H13F2NO2 |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN(CC(F)F)C1 |
| InChI | InChI=1S/C8H13F2NO2/c9-7(10)5-11-3-1-2-6(4-11)8(12)13/h6-7H,1-5H2,(H,12,13)/t6-/m0/s1 |
| InChIKey | YRZSUTLPFPVMOD-LURJTMIESA-N |
| XLogP | 1.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |