C10H17F2NO2 — CID 28869444
ethyl (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylate (PubChem CID 28869444) has the molecular formula C10H17F2NO2 and a molecular weight of 221.25 g/mol. Its IUPAC name is ethyl (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 28869444 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | ethyl (3S)-1-(2,2-difluoroethyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(CC(F)F)C1 |
| InChI | InChI=1S/C10H17F2NO2/c1-2-15-10(14)8-4-3-5-13(6-8)7-9(11)12/h8-9H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | OABUDWSXAXKABV-QMMMGPOBSA-N |
| XLogP | 1.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |