C23H24BrNO7 — CID 28872368
3-O-ethyl 6-O-methyl (4R,6R,7S)-4-(6-bromo-1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 28872368) has the molecular formula C23H24BrNO7 and a molecular weight of 506.35 g/mol. Its IUPAC name is 3-O-ethyl 6-O-methyl (4R,6R,7S)-4-(6-bromo-1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-ethyl 6-O-methyl (4R,6R,7S)-4-(6-bromo-1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 28872368 |
| Molecular Formula | C23H24BrNO7 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 3-O-ethyl 6-O-methyl (4R,6R,7S)-4-(6-bromo-1,3-benzodioxol-5-yl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC2=C(C(=O)[C@H](C(=O)OC)[C@@H](C)C2)[C@H]1c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C23H24BrNO7/c1-5-30-23(28)18-11(3)25-14-6-10(2)17(22(27)29-4)21(26)20(14)19(18)12-7-15-16(8-13(12)24)32-9-31-15/h7-8,10,17,19,25H,5-6,9H2,1-4H3/t10-,17+,19-/m0/s1 |
| InChIKey | FKMZTZBEAILYSW-APTWFODQSA-N |
| XLogP | 3.35 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|