C22H22IN3O — CID 28872870
(2R)-2-(4-iodo-3-methylanilino)-N-[(E)-1-naphthalen-2-ylethylideneamino]propanamide (PubChem CID 28872870) has the molecular formula C22H22IN3O and a molecular weight of 471.34 g/mol. Its IUPAC name is (2R)-2-(4-iodo-3-methylanilino)-N-[(E)-1-naphthalen-2-ylethylideneamino]propanamide.
| Compound Name | (2R)-2-(4-iodo-3-methylanilino)-N-[(E)-1-naphthalen-2-ylethylideneamino]propanamide |
|---|---|
| PubChem CID | 28872870 |
| Molecular Formula | C22H22IN3O |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | (2R)-2-(4-iodo-3-methylanilino)-N-[(E)-1-naphthalen-2-ylethylideneamino]propanamide |
| SMILES | C/C(=N\NC(=O)[C@@H](C)Nc1ccc(I)c(C)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H22IN3O/c1-14-12-20(10-11-21(14)23)24-16(3)22(27)26-25-15(2)18-9-8-17-6-4-5-7-19(17)13-18/h4-13,16,24H,1-3H3,(H,26,27)/b25-15+/t16-/m1/s1 |
| InChIKey | LROLSFAMJMEQSR-FYHAJLKWSA-N |
| XLogP | 5.09 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|