C21H21N3O — CID 6858361
(2S)-2-(naphthalen-2-ylamino)-N-[(Z)-1-phenylethylideneamino]propanamide (PubChem CID 6858361) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (2S)-2-(naphthalen-2-ylamino)-N-[(Z)-1-phenylethylideneamino]propanamide.
| Compound Name | (2S)-2-(naphthalen-2-ylamino)-N-[(Z)-1-phenylethylideneamino]propanamide |
|---|---|
| PubChem CID | 6858361 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (2S)-2-(naphthalen-2-ylamino)-N-[(Z)-1-phenylethylideneamino]propanamide |
| SMILES | C/C(=N/NC(=O)[C@H](C)Nc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C21H21N3O/c1-15(17-8-4-3-5-9-17)23-24-21(25)16(2)22-20-13-12-18-10-6-7-11-19(18)14-20/h3-14,16,22H,1-2H3,(H,24,25)/b23-15-/t16-/m0/s1 |
| InChIKey | ZJANYEFRHZDYCZ-VBHMAFOESA-N |
| XLogP | 4.18 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|