C15H15F2NO — CID 28879073
N-[(2-ethoxyphenyl)methyl]-2,6-difluoroaniline (PubChem CID 28879073) has the molecular formula C15H15F2NO and a molecular weight of 263.29 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-2,6-difluoroaniline.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 28879073 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-2,6-difluoroaniline |
| SMILES | CCOc1ccccc1CNc1c(F)cccc1F |
| InChI | InChI=1S/C15H15F2NO/c1-2-19-14-9-4-3-6-11(14)10-18-15-12(16)7-5-8-13(15)17/h3-9,18H,2,10H2,1H3 |
| InChIKey | TVAOSXNYZHBRFW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |