C13H10F2IN — CID 28879228
N-[(3,4-difluorophenyl)methyl]-3-iodoaniline (PubChem CID 28879228) has the molecular formula C13H10F2IN and a molecular weight of 345.13 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-3-iodoaniline.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-3-iodoaniline |
|---|---|
| PubChem CID | 28879228 |
| Molecular Formula | C13H10F2IN |
| Molecular Weight | 345.13 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-3-iodoaniline |
| SMILES | Fc1ccc(CNc2cccc(I)c2)cc1F |
| InChI | InChI=1S/C13H10F2IN/c14-12-5-4-9(6-13(12)15)8-17-11-3-1-2-10(16)7-11/h1-7,17H,8H2 |
| InChIKey | JWVORNJHXNDYMX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.13 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|