C26H30FNO5 — CID 28881748
3-O-cyclohexyl 6-O-methyl (4R,6S,7S)-4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 28881748) has the molecular formula C26H30FNO5 and a molecular weight of 455.53 g/mol. Its IUPAC name is 3-O-cyclohexyl 6-O-methyl (4R,6S,7S)-4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cyclohexyl 6-O-methyl (4R,6S,7S)-4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 28881748 |
| Molecular Formula | C26H30FNO5 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 3-O-cyclohexyl 6-O-methyl (4R,6S,7S)-4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C2=C(C[C@@H]1C)NC(C)=C(C(=O)OC1CCCCC1)[C@@H]2c1ccccc1F |
| InChI | InChI=1S/C26H30FNO5/c1-14-13-19-23(24(29)20(14)25(30)32-3)22(17-11-7-8-12-18(17)27)21(15(2)28-19)26(31)33-16-9-5-4-6-10-16/h7-8,11-12,14,16,20,22,28H,4-6,9-10,13H2,1-3H3/t14-,20-,22-/m0/s1 |
| InChIKey | BSFZBQSJRQJAHK-FSJXIACGSA-N |
| XLogP | 4.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|