C27H32FNO5 — CID 5322588
3-O-cycloheptyl 6-O-methyl 4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 5322588) has the molecular formula C27H32FNO5 and a molecular weight of 469.55 g/mol. Its IUPAC name is 3-O-cycloheptyl 6-O-methyl 4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cycloheptyl 6-O-methyl 4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 5322588 |
| Molecular Formula | C27H32FNO5 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 3-O-cycloheptyl 6-O-methyl 4-(2-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)C1C(=O)C2=C(CC1C)NC(C)=C(C(=O)OC1CCCCCC1)C2c1ccccc1F |
| InChI | InChI=1S/C27H32FNO5/c1-15-14-20-24(25(30)21(15)26(31)33-3)23(18-12-8-9-13-19(18)28)22(16(2)29-20)27(32)34-17-10-6-4-5-7-11-17/h8-9,12-13,15,17,21,23,29H,4-7,10-11,14H2,1-3H3 |
| InChIKey | UCECTPQPSJGOAW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|