C11H19N3O2S — CID 28894518
4-N-(diethylsulfamoyl)-4-N-methylbenzene-1,4-diamine (PubChem CID 28894518) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-N-(diethylsulfamoyl)-4-N-methylbenzene-1,4-diamine.
| Compound Name | 4-N-(diethylsulfamoyl)-4-N-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 28894518 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 4-N-(diethylsulfamoyl)-4-N-methylbenzene-1,4-diamine |
| SMILES | CCN(CC)S(=O)(=O)N(C)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H19N3O2S/c1-4-14(5-2)17(15,16)13(3)11-8-6-10(12)7-9-11/h6-9H,4-5,12H2,1-3H3 |
| InChIKey | WOEIBQYVRAFCRM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|