C16H16F3N3O2 — CID 28902871
2,3,4-trifluoro-N-[6-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-pyridinyl]benzamide (PubChem CID 28902871) has the molecular formula C16H16F3N3O2 and a molecular weight of 339.32 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[6-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-pyridinyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[6-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 28902871 |
| Molecular Formula | C16H16F3N3O2 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2,3,4-trifluoro-N-[6-[(1-hydroxy-2-methylpropan-2-yl)amino]-3-pyridinyl]benzamide |
| SMILES | CC(C)(CO)Nc1ccc(NC(=O)c2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-16(2,8-23)22-12-6-3-9(7-20-12)21-15(24)10-4-5-11(17)14(19)13(10)18/h3-7,23H,8H2,1-2H3,(H,20,22)(H,21,24) |
| InChIKey | RSVRPMWPQQIZTF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|