C20H17IN2O3 — CID 2892418
N-[1-(3-iodoanilino)-2-(4-methylphenyl)-2-oxoethyl]furan-2-carboxamide (PubChem CID 2892418) has the molecular formula C20H17IN2O3 and a molecular weight of 460.27 g/mol. Its IUPAC name is N-[1-(3-iodoanilino)-2-(4-methylphenyl)-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[1-(3-iodoanilino)-2-(4-methylphenyl)-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2892418 |
| Molecular Formula | C20H17IN2O3 |
| Molecular Weight | 460.27 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | N-[1-(3-iodoanilino)-2-(4-methylphenyl)-2-oxoethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(=O)C(NC(=O)c2ccco2)Nc2cccc(I)c2)cc1 |
| InChI | InChI=1S/C20H17IN2O3/c1-13-7-9-14(10-8-13)18(24)19(22-16-5-2-4-15(21)12-16)23-20(25)17-6-3-11-26-17/h2-12,19,22H,1H3,(H,23,25) |
| InChIKey | OBIXKWPOGHHJOT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|