C20H15N2O5- — CID 7085502
2-[[(1R)-1-(furan-2-carbonylamino)-2-oxo-2-phenylethyl]amino]benzoate (PubChem CID 7085502) has the molecular formula C20H15N2O5- and a molecular weight of 363.35 g/mol. Its IUPAC name is 2-[[(1R)-1-(furan-2-carbonylamino)-2-oxo-2-phenylethyl]amino]benzoate.
| Compound Name | 2-[[(1R)-1-(furan-2-carbonylamino)-2-oxo-2-phenylethyl]amino]benzoate |
|---|---|
| PubChem CID | 7085502 |
| Molecular Formula | C20H15N2O5- |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[[(1R)-1-(furan-2-carbonylamino)-2-oxo-2-phenylethyl]amino]benzoate |
| SMILES | O=C(N[C@@H](Nc1ccccc1C(=O)[O-])C(=O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C20H16N2O5/c23-17(13-7-2-1-3-8-13)18(22-19(24)16-11-6-12-27-16)21-15-10-5-4-9-14(15)20(25)26/h1-12,18,21H,(H,22,24)(H,25,26)/p-1/t18-/m1/s1 |
| InChIKey | LGPOPDDSNTWOAE-GOSISDBHSA-M |
| XLogP | 1.69 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|