C24H23N3O2S — CID 28935734
4-methyl-N-[2-(naphthalen-1-ylamino)ethyl]-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide (PubChem CID 28935734) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is 4-methyl-N-[2-(naphthalen-1-ylamino)ethyl]-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[2-(naphthalen-1-ylamino)ethyl]-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 28935734 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-methyl-N-[2-(naphthalen-1-ylamino)ethyl]-2-(phenoxymethyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(COc2ccccc2)sc1C(=O)NCCNc1cccc2ccccc12 |
| InChI | InChI=1S/C24H23N3O2S/c1-17-23(30-22(27-17)16-29-19-10-3-2-4-11-19)24(28)26-15-14-25-21-13-7-9-18-8-5-6-12-20(18)21/h2-13,25H,14-16H2,1H3,(H,26,28) |
| InChIKey | JDPYIKORQXLSJJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|