C15H16BrN3O6 — CID 2893846
2-methoxyethyl 4-(4-bromo-3-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 2893846) has the molecular formula C15H16BrN3O6 and a molecular weight of 414.21 g/mol. Its IUPAC name is 2-methoxyethyl 4-(4-bromo-3-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-(4-bromo-3-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2893846 |
| Molecular Formula | C15H16BrN3O6 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 2-methoxyethyl 4-(4-bromo-3-nitrophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC(=O)NC1c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H16BrN3O6/c1-8-12(14(20)25-6-5-24-2)13(18-15(21)17-8)9-3-4-10(16)11(7-9)19(22)23/h3-4,7,13H,5-6H2,1-2H3,(H2,17,18,21) |
| InChIKey | IMIXVACKWLASLO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|