C20H18N3O7- — CID 7219045
4-[(4S)-6-methyl-2-oxo-5-(2-phenoxyethoxycarbonyl)-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate (PubChem CID 7219045) has the molecular formula C20H18N3O7- and a molecular weight of 412.38 g/mol. Its IUPAC name is 4-[(4S)-6-methyl-2-oxo-5-(2-phenoxyethoxycarbonyl)-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate.
| Compound Name | 4-[(4S)-6-methyl-2-oxo-5-(2-phenoxyethoxycarbonyl)-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate |
|---|---|
| PubChem CID | 7219045 |
| Molecular Formula | C20H18N3O7- |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4-[(4S)-6-methyl-2-oxo-5-(2-phenoxyethoxycarbonyl)-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate |
| SMILES | CC1=C(C(=O)OCCOc2ccccc2)[C@H](c2ccc([O-])c([N+](=O)[O-])c2)NC(=O)N1 |
| InChI | InChI=1S/C20H19N3O7/c1-12-17(19(25)30-10-9-29-14-5-3-2-4-6-14)18(22-20(26)21-12)13-7-8-16(24)15(11-13)23(27)28/h2-8,11,18,24H,9-10H2,1H3,(H2,21,22,26)/p-1/t18-/m0/s1 |
| InChIKey | FSZMQNDQHGDUOZ-SFHVURJKSA-M |
| XLogP | 1.92 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|