C20H18N3O6- — CID 6981657
4-[(4S)-6-methyl-5-[(4-methylphenyl)methoxycarbonyl]-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate (PubChem CID 6981657) has the molecular formula C20H18N3O6- and a molecular weight of 396.38 g/mol. Its IUPAC name is 4-[(4S)-6-methyl-5-[(4-methylphenyl)methoxycarbonyl]-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate.
| Compound Name | 4-[(4S)-6-methyl-5-[(4-methylphenyl)methoxycarbonyl]-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate |
|---|---|
| PubChem CID | 6981657 |
| Molecular Formula | C20H18N3O6- |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-[(4S)-6-methyl-5-[(4-methylphenyl)methoxycarbonyl]-2-oxo-3,4-dihydro-1H-pyrimidin-4-yl]-2-nitrophenolate |
| SMILES | CC1=C(C(=O)OCc2ccc(C)cc2)[C@H](c2ccc([O-])c([N+](=O)[O-])c2)NC(=O)N1 |
| InChI | InChI=1S/C20H19N3O6/c1-11-3-5-13(6-4-11)10-29-19(25)17-12(2)21-20(26)22-18(17)14-7-8-16(24)15(9-14)23(27)28/h3-9,18,24H,10H2,1-2H3,(H2,21,22,26)/p-1/t18-/m0/s1 |
| InChIKey | CAXBMMDDYJGQBV-SFHVURJKSA-M |
| XLogP | 2.35 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|