C13H27N3O3S — CID 28940738
N-[1-(aminomethyl)-4-ethylcyclohexyl]morpholine-4-sulfonamide (PubChem CID 28940738) has the molecular formula C13H27N3O3S and a molecular weight of 305.44 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-ethylcyclohexyl]morpholine-4-sulfonamide.
| Compound Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 28940738 |
| Molecular Formula | C13H27N3O3S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]morpholine-4-sulfonamide |
| SMILES | CCC1CCC(CN)(NS(=O)(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C13H27N3O3S/c1-2-12-3-5-13(11-14,6-4-12)15-20(17,18)16-7-9-19-10-8-16/h12,15H,2-11,14H2,1H3 |
| InChIKey | OSMMMNRYLSGBNA-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |