C13H24N4O2S — CID 104709256
N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpyrazole-3-sulfonamide (PubChem CID 104709256) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709256 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[1-(aminomethyl)-4-ethylcyclohexyl]-2-methylpyrazole-3-sulfonamide |
| SMILES | CCC1CCC(CN)(NS(=O)(=O)c2ccnn2C)CC1 |
| InChI | InChI=1S/C13H24N4O2S/c1-3-11-4-7-13(10-14,8-5-11)16-20(18,19)12-6-9-15-17(12)2/h6,9,11,16H,3-5,7-8,10,14H2,1-2H3 |
| InChIKey | HMKCDPQKYOAXDK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |