C14H26N4O2S — CID 104709314
N-[1-(aminomethyl)-4-methylcyclohexyl]-N-ethyl-2-methylpyrazole-3-sulfonamide (PubChem CID 104709314) has the molecular formula C14H26N4O2S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-[1-(aminomethyl)-4-methylcyclohexyl]-N-ethyl-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-[1-(aminomethyl)-4-methylcyclohexyl]-N-ethyl-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709314 |
| Molecular Formula | C14H26N4O2S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-[1-(aminomethyl)-4-methylcyclohexyl]-N-ethyl-2-methylpyrazole-3-sulfonamide |
| SMILES | CCN(C1(CN)CCC(C)CC1)S(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C14H26N4O2S/c1-4-18(14(11-15)8-5-12(2)6-9-14)21(19,20)13-7-10-16-17(13)3/h7,10,12H,4-6,8-9,11,15H2,1-3H3 |
| InChIKey | JVVGUVJNADEDNM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |