C13H21N3O4S — CID 104709737
4-methyl-1-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 104709737) has the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-methyl-1-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-methyl-1-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 104709737 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 4-methyl-1-[[(2-methylpyrazol-3-yl)sulfonylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(CNS(=O)(=O)c2ccnn2C)(C(=O)O)CC1 |
| InChI | InChI=1S/C13H21N3O4S/c1-10-3-6-13(7-4-10,12(17)18)9-15-21(19,20)11-5-8-14-16(11)2/h5,8,10,15H,3-4,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | XDHQEIVNCFXWDW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |