C14H21FN2O — CID 28945751
[3-fluoro-4-(4-propylpiperazin-1-yl)phenyl]methanol (PubChem CID 28945751) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is [3-fluoro-4-(4-propylpiperazin-1-yl)phenyl]methanol.
| Compound Name | [3-fluoro-4-(4-propylpiperazin-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 28945751 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [3-fluoro-4-(4-propylpiperazin-1-yl)phenyl]methanol |
| SMILES | CCCN1CCN(c2ccc(CO)cc2F)CC1 |
| InChI | InChI=1S/C14H21FN2O/c1-2-5-16-6-8-17(9-7-16)14-4-3-12(11-18)10-13(14)15/h3-4,10,18H,2,5-9,11H2,1H3 |
| InChIKey | JRODGESTHRORPR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|