C13H16F4N2O — CID 62966483
[3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]methanol (PubChem CID 62966483) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is [3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]methanol.
| Compound Name | [3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 62966483 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [3-fluoro-4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]phenyl]methanol |
| SMILES | OCc1ccc(N2CCN(CC(F)(F)F)CC2)c(F)c1 |
| InChI | InChI=1S/C13H16F4N2O/c14-11-7-10(8-20)1-2-12(11)19-5-3-18(4-6-19)9-13(15,16)17/h1-2,7,20H,3-6,8-9H2 |
| InChIKey | ZUZPVDJPQMHBJP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|