C13H20N2O3S2 — CID 28951891
N-[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide (PubChem CID 28951891) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is N-[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide.
| Compound Name | N-[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 28951891 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2,2-dimethylpropanamide |
| SMILES | C=CCN1/C(=N/C(=O)C(C)(C)C)S[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H20N2O3S2/c1-5-6-15-9-7-20(17,18)8-10(9)19-12(15)14-11(16)13(2,3)4/h5,9-10H,1,6-8H2,2-4H3/b14-12-/t9-,10+/m1/s1 |
| InChIKey | AREHHMRUUCSVOJ-XPCIQDFASA-N |
| XLogP | 1.32 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|