C13H18N2O5S2 — CID 7740849
5-[[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid (PubChem CID 7740849) has the molecular formula C13H18N2O5S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-[[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 7740849 |
| Molecular Formula | C13H18N2O5S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 5-[[(3aR,6aR)-5,5-dioxo-3-prop-2-enyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
| SMILES | C=CCN1/C(=N/C(=O)CCCC(=O)O)S[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C13H18N2O5S2/c1-2-6-15-9-7-22(19,20)8-10(9)21-13(15)14-11(16)4-3-5-12(17)18/h2,9-10H,1,3-8H2,(H,17,18)/b14-13-/t9-,10+/m1/s1 |
| InChIKey | VXOBHIRWZAYFQY-HMMHSFKJSA-N |
| XLogP | 0.52 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|