C22H38N2O4 — CID 28959379
methyl 1-[2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetyl]piperidine-4-carboxylate (PubChem CID 28959379) has the molecular formula C22H38N2O4 and a molecular weight of 394.56 g/mol. Its IUPAC name is methyl 1-[2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 28959379 |
| Molecular Formula | C22H38N2O4 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | methyl 1-[2-[(3R,4S)-3-ethyl-1-hexanoylpiperidin-4-yl]acetyl]piperidine-4-carboxylate |
| SMILES | CCCCCC(=O)N1CC[C@@H](CC(=O)N2CCC(C(=O)OC)CC2)[C@@H](CC)C1 |
| InChI | InChI=1S/C22H38N2O4/c1-4-6-7-8-20(25)24-14-11-19(17(5-2)16-24)15-21(26)23-12-9-18(10-13-23)22(27)28-3/h17-19H,4-16H2,1-3H3/t17-,19-/m0/s1 |
| InChIKey | NESLEACASUWFRN-HKUYNNGSSA-N |
| XLogP | 3.24 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|