C18H32N2O2 — CID 78522758
2-(3-ethyl-1-hexanoylpiperidin-4-yl)-N-prop-2-enylacetamide (PubChem CID 78522758) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 2-(3-ethyl-1-hexanoylpiperidin-4-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(3-ethyl-1-hexanoylpiperidin-4-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 78522758 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 2-(3-ethyl-1-hexanoylpiperidin-4-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CC1CCN(C(=O)CCCCC)CC1CC |
| InChI | InChI=1S/C18H32N2O2/c1-4-7-8-9-18(22)20-12-10-16(15(6-3)14-20)13-17(21)19-11-5-2/h5,15-16H,2,4,6-14H2,1,3H3,(H,19,21) |
| InChIKey | JSSSIAGRTKQUAA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|