C18H24ClN3O2 — CID 162812191
2-[(3S,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]-N-prop-2-enylacetamide (PubChem CID 162812191) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 2-[(3S,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(3S,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 162812191 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[(3S,4S)-1-(2-chloropyridine-4-carbonyl)-3-ethylpiperidin-4-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)C[C@@H]1CCN(C(=O)c2ccnc(Cl)c2)C[C@H]1CC |
| InChI | InChI=1S/C18H24ClN3O2/c1-3-7-21-17(23)11-14-6-9-22(12-13(14)4-2)18(24)15-5-8-20-16(19)10-15/h3,5,8,10,13-14H,1,4,6-7,9,11-12H2,2H3,(H,21,23)/t13-,14+/m1/s1 |
| InChIKey | FLMLEHWDAWZNNF-KGLIPLIRSA-N |
| XLogP | 2.92 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|