C22H31ClN4O4 — CID 25312874
2-[(3R,4S)-3-[2-(4-acetyl-1,4-diazepan-1-ium-1-yl)ethyl]-1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]acetate (PubChem CID 25312874) has the molecular formula C22H31ClN4O4 and a molecular weight of 450.97 g/mol. Its IUPAC name is 2-[(3R,4S)-3-[2-(4-acetyl-1,4-diazepan-1-ium-1-yl)ethyl]-1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]acetate.
| Compound Name | 2-[(3R,4S)-3-[2-(4-acetyl-1,4-diazepan-1-ium-1-yl)ethyl]-1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 25312874 |
| Molecular Formula | C22H31ClN4O4 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[(3R,4S)-3-[2-(4-acetyl-1,4-diazepan-1-ium-1-yl)ethyl]-1-(2-chloropyridine-4-carbonyl)piperidin-4-yl]acetate |
| SMILES | CC(=O)N1CCC[NH+](CC[C@H]2CN(C(=O)c3ccnc(Cl)c3)CC[C@H]2CC(=O)[O-])CC1 |
| InChI | InChI=1S/C22H31ClN4O4/c1-16(28)26-8-2-7-25(11-12-26)9-4-19-15-27(10-5-17(19)14-21(29)30)22(31)18-3-6-24-20(23)13-18/h3,6,13,17,19H,2,4-5,7-12,14-15H2,1H3,(H,29,30)/t17-,19-/m0/s1 |
| InChIKey | AESKMZLXPSQNTD-HKUYNNGSSA-N |
| XLogP | -0.52 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|