About 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate
2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate (PubChem CID 28959706) has the molecular formula C22H32N2O3
and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate.
Molecular Properties
| Compound Name | 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate |
| PubChem CID | 28959706 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate |
| SMILES | O=C([O-])C[C@@H]1CCN(C(=O)Cc2ccccc2)C[C@@H]1CC[NH+]1CCCCC1 |
| InChI | InChI=1S/C22H32N2O3/c25-21(15-18-7-3-1-4-8-18)24-14-10-19(16-22(26)27)20(17-24)9-13-23-11-5-2-6-12-23/h1,3-4,7-8,19-20H,2,5-6,9-17H2,(H,26,27)/t19-,20-/m0/s1 |
| InChIKey | BNHUETPBMYNXAG-PMACEKPBSA-N |
| XLogP | 0.29 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate?
The IUPAC name of 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate (CID 28959706) is 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate.
What is the SMILES notation for 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate?
The canonical SMILES for 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate is O=C([O-])C[C@@H]1CCN(C(=O)Cc2ccccc2)C[C@@H]1CC[NH+]1CCCCC1.
What is the InChIKey of 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate?
The InChIKey is BNHUETPBMYNXAG-PMACEKPBSA-N. The full InChI is InChI=1S/C22H32N2O3/c25-21(15-18-7-3-1-4-8-18)24-14-10-19(16-22(26)27)20(17-24)9-13-23-11-5-2-6-12-23/h1,3-4,7-8,19-20H,2,5-6,9-17H2,(H,26,27)/t19-,20-/m0/s1.
What are the key properties of 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate?
2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate has a molecular weight of 372.51 g/mol, XLogP of 0.29, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,4S)-1-(2-phenylacetyl)-3-(2-piperidin-1-ium-1-ylethyl)piperidin-4-yl]acetate is sourced from PubChem (CID 28959706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).