C13H14BrNS — CID 28972836
N-[(4-bromothiophen-2-yl)methyl]-2,4-dimethylaniline (PubChem CID 28972836) has the molecular formula C13H14BrNS and a molecular weight of 296.23 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2,4-dimethylaniline.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 28972836 |
| Molecular Formula | C13H14BrNS |
| Molecular Weight | 296.23 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2cc(Br)cs2)c(C)c1 |
| InChI | InChI=1S/C13H14BrNS/c1-9-3-4-13(10(2)5-9)15-7-12-6-11(14)8-16-12/h3-6,8,15H,7H2,1-2H3 |
| InChIKey | QBDVDBRKBYKXNE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |