C11H10BrIN2S — CID 66095012
1-N-[(4-bromothiophen-2-yl)methyl]-2-iodobenzene-1,4-diamine (PubChem CID 66095012) has the molecular formula C11H10BrIN2S and a molecular weight of 409.09 g/mol. Its IUPAC name is 1-N-[(4-bromothiophen-2-yl)methyl]-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-[(4-bromothiophen-2-yl)methyl]-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 66095012 |
| Molecular Formula | C11H10BrIN2S |
| Molecular Weight | 409.09 g/mol |
| Exact Mass | 407.88 |
| IUPAC Name | 1-N-[(4-bromothiophen-2-yl)methyl]-2-iodobenzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2cc(Br)cs2)c(I)c1 |
| InChI | InChI=1S/C11H10BrIN2S/c12-7-3-9(16-6-7)5-15-11-2-1-8(14)4-10(11)13/h1-4,6,15H,5,14H2 |
| InChIKey | UUVICNYJGURGTB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.09 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|