C13H12FIN2 — CID 66094964
1-N-[(4-fluorophenyl)methyl]-2-iodobenzene-1,4-diamine (PubChem CID 66094964) has the molecular formula C13H12FIN2 and a molecular weight of 342.16 g/mol. Its IUPAC name is 1-N-[(4-fluorophenyl)methyl]-2-iodobenzene-1,4-diamine.
| Compound Name | 1-N-[(4-fluorophenyl)methyl]-2-iodobenzene-1,4-diamine |
|---|---|
| PubChem CID | 66094964 |
| Molecular Formula | C13H12FIN2 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 1-N-[(4-fluorophenyl)methyl]-2-iodobenzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2ccc(F)cc2)c(I)c1 |
| InChI | InChI=1S/C13H12FIN2/c14-10-3-1-9(2-4-10)8-17-13-6-5-11(16)7-12(13)15/h1-7,17H,8,16H2 |
| InChIKey | YHFJYPIJCWGUQL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|