C14H12F3IN2 — CID 66093731
2-iodo-1-N-[[3-(trifluoromethyl)phenyl]methyl]benzene-1,4-diamine (PubChem CID 66093731) has the molecular formula C14H12F3IN2 and a molecular weight of 392.16 g/mol. Its IUPAC name is 2-iodo-1-N-[[3-(trifluoromethyl)phenyl]methyl]benzene-1,4-diamine.
| Compound Name | 2-iodo-1-N-[[3-(trifluoromethyl)phenyl]methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 66093731 |
| Molecular Formula | C14H12F3IN2 |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-iodo-1-N-[[3-(trifluoromethyl)phenyl]methyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2cccc(C(F)(F)F)c2)c(I)c1 |
| InChI | InChI=1S/C14H12F3IN2/c15-14(16,17)10-3-1-2-9(6-10)8-20-13-5-4-11(19)7-12(13)18/h1-7,20H,8,19H2 |
| InChIKey | OMVXDXBAXQUVKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|