C14H13IN2O2S2 — CID 28978442
2-[(2-iodophenyl)sulfamoylmethyl]benzenecarbothioamide (PubChem CID 28978442) has the molecular formula C14H13IN2O2S2 and a molecular weight of 432.31 g/mol. Its IUPAC name is 2-[(2-iodophenyl)sulfamoylmethyl]benzenecarbothioamide.
| Compound Name | 2-[(2-iodophenyl)sulfamoylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 28978442 |
| Molecular Formula | C14H13IN2O2S2 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 2-[(2-iodophenyl)sulfamoylmethyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccccc1CS(=O)(=O)Nc1ccccc1I |
| InChI | InChI=1S/C14H13IN2O2S2/c15-12-7-3-4-8-13(12)17-21(18,19)9-10-5-1-2-6-11(10)14(16)20/h1-8,17H,9H2,(H2,16,20) |
| InChIKey | KFJKGDUYAOMLLW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|