C12H13N3O2S3 — CID 29294145
2-[(5-methyl-1,3-thiazol-2-yl)sulfamoylmethyl]benzenecarbothioamide (PubChem CID 29294145) has the molecular formula C12H13N3O2S3 and a molecular weight of 327.46 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-thiazol-2-yl)sulfamoylmethyl]benzenecarbothioamide.
| Compound Name | 2-[(5-methyl-1,3-thiazol-2-yl)sulfamoylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 29294145 |
| Molecular Formula | C12H13N3O2S3 |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-[(5-methyl-1,3-thiazol-2-yl)sulfamoylmethyl]benzenecarbothioamide |
| SMILES | Cc1cnc(NS(=O)(=O)Cc2ccccc2C(N)=S)s1 |
| InChI | InChI=1S/C12H13N3O2S3/c1-8-6-14-12(19-8)15-20(16,17)7-9-4-2-3-5-10(9)11(13)18/h2-6H,7H2,1H3,(H2,13,18)(H,14,15) |
| InChIKey | NPHXOKNUTBZNPB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|