C12H10Cl3NS — CID 28992364
2,4,6-trichloro-N-[(5-methylthiophen-2-yl)methyl]aniline (PubChem CID 28992364) has the molecular formula C12H10Cl3NS and a molecular weight of 306.65 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[(5-methylthiophen-2-yl)methyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[(5-methylthiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 28992364 |
| Molecular Formula | C12H10Cl3NS |
| Molecular Weight | 306.65 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 2,4,6-trichloro-N-[(5-methylthiophen-2-yl)methyl]aniline |
| SMILES | Cc1ccc(CNc2c(Cl)cc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C12H10Cl3NS/c1-7-2-3-9(17-7)6-16-12-10(14)4-8(13)5-11(12)15/h2-5,16H,6H2,1H3 |
| InChIKey | VELJKYJPAFMNAT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |