C11H7BrCl3NS — CID 28992400
N-[(5-bromothiophen-2-yl)methyl]-2,4,6-trichloroaniline (PubChem CID 28992400) has the molecular formula C11H7BrCl3NS and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2,4,6-trichloroaniline.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2,4,6-trichloroaniline |
|---|---|
| PubChem CID | 28992400 |
| Molecular Formula | C11H7BrCl3NS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 368.85 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2,4,6-trichloroaniline |
| SMILES | Clc1cc(Cl)c(NCc2ccc(Br)s2)c(Cl)c1 |
| InChI | InChI=1S/C11H7BrCl3NS/c12-10-2-1-7(17-10)5-16-11-8(14)3-6(13)4-9(11)15/h1-4,16H,5H2 |
| InChIKey | MITKROGKDXCDKC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |