C12H10BrClN2O2S — CID 141181051
[4-[(5-bromothiophen-2-yl)methylamino]-2-chlorophenyl]carbamic acid (PubChem CID 141181051) has the molecular formula C12H10BrClN2O2S and a molecular weight of 361.65 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methylamino]-2-chlorophenyl]carbamic acid.
| Compound Name | [4-[(5-bromothiophen-2-yl)methylamino]-2-chlorophenyl]carbamic acid |
|---|---|
| PubChem CID | 141181051 |
| Molecular Formula | C12H10BrClN2O2S |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methylamino]-2-chlorophenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(NCc2ccc(Br)s2)cc1Cl |
| InChI | InChI=1S/C12H10BrClN2O2S/c13-11-4-2-8(19-11)6-15-7-1-3-10(9(14)5-7)16-12(17)18/h1-5,15-16H,6H2,(H,17,18) |
| InChIKey | VQLDDWCLQZOAET-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |