C24H25NO4 — CID 29005620
(2Z)-2-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]-3-oxo-7-(piperidin-1-ium-1-ylmethyl)-1-benzofuran-6-olate (PubChem CID 29005620) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]-3-oxo-7-(piperidin-1-ium-1-ylmethyl)-1-benzofuran-6-olate.
| Compound Name | (2Z)-2-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]-3-oxo-7-(piperidin-1-ium-1-ylmethyl)-1-benzofuran-6-olate |
|---|---|
| PubChem CID | 29005620 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (2Z)-2-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]-3-oxo-7-(piperidin-1-ium-1-ylmethyl)-1-benzofuran-6-olate |
| SMILES | COc1ccccc1/C=C/C=C1\Oc2c(ccc([O-])c2C[NH+]2CCCCC2)C1=O |
| InChI | InChI=1S/C24H25NO4/c1-28-21-10-4-3-8-17(21)9-7-11-22-23(27)18-12-13-20(26)19(24(18)29-22)16-25-14-5-2-6-15-25/h3-4,7-13,26H,2,5-6,14-16H2,1H3/b9-7+,22-11- |
| InChIKey | RZHAGHCGZZAUND-TUVYINGVSA-N |
| XLogP | 2.51 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|