C12H28N2O — CID 29014274
N-[(2R)-4-methoxy-4-methylpentan-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 29014274) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is N-[(2R)-4-methoxy-4-methylpentan-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(2R)-4-methoxy-4-methylpentan-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 29014274 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N-[(2R)-4-methoxy-4-methylpentan-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | COC(C)(C)C[C@@H](C)NCCCN(C)C |
| InChI | InChI=1S/C12H28N2O/c1-11(10-12(2,3)15-6)13-8-7-9-14(4)5/h11,13H,7-10H2,1-6H3/t11-/m1/s1 |
| InChIKey | YIUFSNNZNUBEIL-LLVKDONJSA-N |
| XLogP | 1.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|