C23H26N6O2S — CID 29026246
2-[(2R)-3-oxo-1-[(4-phenylphenyl)methyl]piperazin-2-yl]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide (PubChem CID 29026246) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 2-[(2R)-3-oxo-1-[(4-phenylphenyl)methyl]piperazin-2-yl]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide.
| Compound Name | 2-[(2R)-3-oxo-1-[(4-phenylphenyl)methyl]piperazin-2-yl]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
|---|---|
| PubChem CID | 29026246 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[(2R)-3-oxo-1-[(4-phenylphenyl)methyl]piperazin-2-yl]-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]acetamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1Cc1ccc(-c2ccccc2)cc1)NCCSc1ncn[nH]1 |
| InChI | InChI=1S/C23H26N6O2S/c30-21(24-11-13-32-23-26-16-27-28-23)14-20-22(31)25-10-12-29(20)15-17-6-8-19(9-7-17)18-4-2-1-3-5-18/h1-9,16,20H,10-15H2,(H,24,30)(H,25,31)(H,26,27,28)/t20-/m1/s1 |
| InChIKey | WCXRADWSWPWNIW-HXUWFJFHSA-N |
| XLogP | 2.07 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|