C16H20FN5O — CID 29029101
5-(3-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-3-amine (PubChem CID 29029101) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(3-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 29029101 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-(3-fluorophenyl)-N-(3-morpholin-4-ylpropyl)-1,2,4-triazin-3-amine |
| SMILES | Fc1cccc(-c2cnnc(NCCCN3CCOCC3)n2)c1 |
| InChI | InChI=1S/C16H20FN5O/c17-14-4-1-3-13(11-14)15-12-19-21-16(20-15)18-5-2-6-22-7-9-23-10-8-22/h1,3-4,11-12H,2,5-10H2,(H,18,20,21) |
| InChIKey | FNFZMVUHCGLKNN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|