C17H17FN2O4 — CID 29029624
(3R)-4-(5-ethoxyfuran-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one (PubChem CID 29029624) has the molecular formula C17H17FN2O4 and a molecular weight of 332.33 g/mol. Its IUPAC name is (3R)-4-(5-ethoxyfuran-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one.
| Compound Name | (3R)-4-(5-ethoxyfuran-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one |
|---|---|
| PubChem CID | 29029624 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (3R)-4-(5-ethoxyfuran-2-carbonyl)-3-(4-fluorophenyl)piperazin-2-one |
| SMILES | CCOc1ccc(C(=O)N2CCNC(=O)[C@H]2c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C17H17FN2O4/c1-2-23-14-8-7-13(24-14)17(22)20-10-9-19-16(21)15(20)11-3-5-12(18)6-4-11/h3-8,15H,2,9-10H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | FZKTVOAUPSEWMI-OAHLLOKOSA-N |
| XLogP | 2.13 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |