C23H34N2O7 — CID 2903567
1-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-4-carboxamide;oxalic acid (PubChem CID 2903567) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-4-carboxamide;oxalic acid.
| Compound Name | 1-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 2903567 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)methyl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-4-carboxamide;oxalic acid |
| SMILES | C=C(C)CN(CC)C(=O)C1CCN(Cc2cc(OC)ccc2OC)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H32N2O3.C2H2O4/c1-6-23(14-16(2)3)21(24)17-9-11-22(12-10-17)15-18-13-19(25-4)7-8-20(18)26-5;3-1(4)2(5)6/h7-8,13,17H,2,6,9-12,14-15H2,1,3-5H3;(H,3,4)(H,5,6) |
| InChIKey | ABWDMHAXHRFDHE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|