C19H29FN2 — CID 29038742
N-[(1R)-1-(3-fluoro-4-piperidin-1-ylphenyl)ethyl]cyclohexanamine (PubChem CID 29038742) has the molecular formula C19H29FN2 and a molecular weight of 304.45 g/mol. Its IUPAC name is N-[(1R)-1-(3-fluoro-4-piperidin-1-ylphenyl)ethyl]cyclohexanamine.
| Compound Name | N-[(1R)-1-(3-fluoro-4-piperidin-1-ylphenyl)ethyl]cyclohexanamine |
|---|---|
| PubChem CID | 29038742 |
| Molecular Formula | C19H29FN2 |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | N-[(1R)-1-(3-fluoro-4-piperidin-1-ylphenyl)ethyl]cyclohexanamine |
| SMILES | C[C@@H](NC1CCCCC1)c1ccc(N2CCCCC2)c(F)c1 |
| InChI | InChI=1S/C19H29FN2/c1-15(21-17-8-4-2-5-9-17)16-10-11-19(18(20)14-16)22-12-6-3-7-13-22/h10-11,14-15,17,21H,2-9,12-13H2,1H3/t15-/m1/s1 |
| InChIKey | VJFOUHYOGRAVLV-OAHLLOKOSA-N |
| XLogP | 4.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|